C15H14O2 — CID 102347696
(2S)-2-hydroxy-2-naphthalen-2-ylcyclopentan-1-one (PubChem CID 102347696) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is (2S)-2-hydroxy-2-naphthalen-2-ylcyclopentan-1-one.
| Compound Name | (2S)-2-hydroxy-2-naphthalen-2-ylcyclopentan-1-one |
|---|---|
| PubChem CID | 102347696 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (2S)-2-hydroxy-2-naphthalen-2-ylcyclopentan-1-one |
| SMILES | O=C1CCC[C@]1(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H14O2/c16-14-6-3-9-15(14,17)13-8-7-11-4-1-2-5-12(11)10-13/h1-2,4-5,7-8,10,17H,3,6,9H2/t15-/m0/s1 |
| InChIKey | TZTVVNFJHHGDMK-HNNXBMFYSA-N |
| XLogP | 2.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |