C33H44O6S — CID 102348388
S-ethyl (E)-4-[(2S)-2-[(2R,3R)-2-[(4-methoxyphenyl)methoxy]-3-(phenylmethoxymethoxy)butyl]-3,4-dihydro-2H-pyran-6-yl]-4-methylpent-2-enethioate (PubChem CID 102348388) has the molecular formula C33H44O6S and a molecular weight of 568.78 g/mol. Its IUPAC name is S-ethyl (E)-4-[(2S)-2-[(2R,3R)-2-[(4-methoxyphenyl)methoxy]-3-(phenylmethoxymethoxy)butyl]-3,4-dihydro-2H-pyran-6-yl]-4-methylpent-2-enethioate.
| Compound Name | S-ethyl (E)-4-[(2S)-2-[(2R,3R)-2-[(4-methoxyphenyl)methoxy]-3-(phenylmethoxymethoxy)butyl]-3,4-dihydro-2H-pyran-6-yl]-4-methylpent-2-enethioate |
|---|---|
| PubChem CID | 102348388 |
| Molecular Formula | C33H44O6S |
| Molecular Weight | 568.78 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | S-ethyl (E)-4-[(2S)-2-[(2R,3R)-2-[(4-methoxyphenyl)methoxy]-3-(phenylmethoxymethoxy)butyl]-3,4-dihydro-2H-pyran-6-yl]-4-methylpent-2-enethioate |
| SMILES | CCSC(=O)/C=C/C(C)(C)C1=CCC[C@@H](C[C@@H](OCc2ccc(OC)cc2)[C@@H](C)OCOCc2ccccc2)O1 |
| InChI | InChI=1S/C33H44O6S/c1-6-40-32(34)19-20-33(3,4)31-14-10-13-29(39-31)21-30(37-23-27-15-17-28(35-5)18-16-27)25(2)38-24-36-22-26-11-8-7-9-12-26/h7-9,11-12,14-20,25,29-30H,6,10,13,21-24H2,1-5H3/b20-19+/t25-,29+,30-/m1/s1 |
| InChIKey | ZGSXDIDFGWGOBG-GSHGQVTGSA-N |
| XLogP | 7.47 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.78 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|