C14H21NO2 — CID 102348539
(3aS,6aS)-3a-acetyl-2-tert-butyl-4-methylidene-1,5,6,6a-tetrahydrocyclopenta[c]pyrrol-3-one (PubChem CID 102348539) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (3aS,6aS)-3a-acetyl-2-tert-butyl-4-methylidene-1,5,6,6a-tetrahydrocyclopenta[c]pyrrol-3-one.
| Compound Name | (3aS,6aS)-3a-acetyl-2-tert-butyl-4-methylidene-1,5,6,6a-tetrahydrocyclopenta[c]pyrrol-3-one |
|---|---|
| PubChem CID | 102348539 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (3aS,6aS)-3a-acetyl-2-tert-butyl-4-methylidene-1,5,6,6a-tetrahydrocyclopenta[c]pyrrol-3-one |
| SMILES | C=C1CC[C@@H]2CN(C(C)(C)C)C(=O)[C@]12C(C)=O |
| InChI | InChI=1S/C14H21NO2/c1-9-6-7-11-8-15(13(3,4)5)12(17)14(9,11)10(2)16/h11H,1,6-8H2,2-5H3/t11-,14+/m1/s1 |
| InChIKey | UOYVCHDFTMRPNG-RISCZKNCSA-N |
| XLogP | 2.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|