C25H25NO2 — CID 102348642
ethyl (2R,3R)-1-benzhydryl-3-(4-methylphenyl)aziridine-2-carboxylate (PubChem CID 102348642) has the molecular formula C25H25NO2 and a molecular weight of 371.48 g/mol. Its IUPAC name is ethyl (2R,3R)-1-benzhydryl-3-(4-methylphenyl)aziridine-2-carboxylate.
| Compound Name | ethyl (2R,3R)-1-benzhydryl-3-(4-methylphenyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 102348642 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | ethyl (2R,3R)-1-benzhydryl-3-(4-methylphenyl)aziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H](c2ccc(C)cc2)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25NO2/c1-3-28-25(27)24-23(21-16-14-18(2)15-17-21)26(24)22(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-17,22-24H,3H2,1-2H3/t23-,24-,26?/m1/s1 |
| InChIKey | CKICLSQQDXFDCI-LBHOTPKDSA-N |
| XLogP | 5.07 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|