C10H17N3O7 — CID 102349769
(2R,3R,4R,5S)-5-(2-methyl-4-nitroimidazol-1-yl)hexane-1,2,3,4,6-pentol (PubChem CID 102349769) has the molecular formula C10H17N3O7 and a molecular weight of 291.26 g/mol. Its IUPAC name is (2R,3R,4R,5S)-5-(2-methyl-4-nitroimidazol-1-yl)hexane-1,2,3,4,6-pentol.
| Compound Name | (2R,3R,4R,5S)-5-(2-methyl-4-nitroimidazol-1-yl)hexane-1,2,3,4,6-pentol |
|---|---|
| PubChem CID | 102349769 |
| Molecular Formula | C10H17N3O7 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (2R,3R,4R,5S)-5-(2-methyl-4-nitroimidazol-1-yl)hexane-1,2,3,4,6-pentol |
| SMILES | Cc1nc([N+](=O)[O-])cn1[C@@H](CO)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H17N3O7/c1-5-11-8(13(19)20)2-12(5)6(3-14)9(17)10(18)7(16)4-15/h2,6-7,9-10,14-18H,3-4H2,1H3/t6-,7+,9+,10-/m0/s1 |
| InChIKey | DSRZCIJRVMDYDF-WDQPUEAGSA-N |
| XLogP | -2.29 |
| TPSA | 162.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|