C32H43NO4Si — CID 102350254
N-benzyl-N-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-yl]hydroxylamine (PubChem CID 102350254) has the molecular formula C32H43NO4Si and a molecular weight of 533.79 g/mol. Its IUPAC name is N-benzyl-N-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-yl]hydroxylamine.
| Compound Name | N-benzyl-N-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 102350254 |
| Molecular Formula | C32H43NO4Si |
| Molecular Weight | 533.79 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | N-benzyl-N-[(2R)-1-[tert-butyl(diphenyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]butan-2-yl]hydroxylamine |
| SMILES | CC[C@@](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)([C@@H]1COC(C)(C)O1)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C32H43NO4Si/c1-7-32(29-24-35-31(5,6)37-29,33(34)23-26-17-11-8-12-18-26)25-36-38(30(2,3)4,27-19-13-9-14-20-27)28-21-15-10-16-22-28/h8-22,29,34H,7,23-25H2,1-6H3/t29-,32+/m0/s1 |
| InChIKey | BHGYVBIFKRYYLE-BHDXBOSCSA-N |
| XLogP | 5.75 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.79 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|