About 4,4'-bis(chloromethyl)-3,3'-spirobi[1,2-dihydroindene]
4,4'-bis(chloromethyl)-3,3'-spirobi[1,2-dihydroindene] (PubChem CID 102350291) has the molecular formula C19H18Cl2
and a molecular weight of 317.26 g/mol. Its IUPAC name is 4,4'-bis(chloromethyl)-3,3'-spirobi[1,2-dihydroindene].
Molecular Properties
| Compound Name | 4,4'-bis(chloromethyl)-3,3'-spirobi[1,2-dihydroindene] |
| PubChem CID | 102350291 |
| Molecular Formula | C19H18Cl2 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 4,4'-bis(chloromethyl)-3,3'-spirobi[1,2-dihydroindene] |
| SMILES | ClCc1cccc2c1C1(CC2)CCc2cccc(CCl)c21 |
| InChI | InChI=1S/C19H18Cl2/c20-11-15-5-1-3-13-7-9-19(17(13)15)10-8-14-4-2-6-16(12-21)18(14)19/h1-6H,7-12H2 |
| InChIKey | SRCURMUXXRANHP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4,4'-bis(chloromethyl)-3,3'-spirobi[1,2-dihydroindene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4'-bis(chloromethyl)-3,3'-spirobi[1,2-dihydroindene]?
The IUPAC name of 4,4'-bis(chloromethyl)-3,3'-spirobi[1,2-dihydroindene] (CID 102350291) is 4,4'-bis(chloromethyl)-3,3'-spirobi[1,2-dihydroindene].
What is the SMILES notation for 4,4'-bis(chloromethyl)-3,3'-spirobi[1,2-dihydroindene]?
The canonical SMILES for 4,4'-bis(chloromethyl)-3,3'-spirobi[1,2-dihydroindene] is ClCc1cccc2c1C1(CC2)CCc2cccc(CCl)c21.
What is the InChIKey of 4,4'-bis(chloromethyl)-3,3'-spirobi[1,2-dihydroindene]?
The InChIKey is SRCURMUXXRANHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18Cl2/c20-11-15-5-1-3-13-7-9-19(17(13)15)10-8-14-4-2-6-16(12-21)18(14)19/h1-6H,7-12H2.
What are the key properties of 4,4'-bis(chloromethyl)-3,3'-spirobi[1,2-dihydroindene]?
4,4'-bis(chloromethyl)-3,3'-spirobi[1,2-dihydroindene] has a molecular weight of 317.26 g/mol, XLogP of 5.34, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4'-bis(chloromethyl)-3,3'-spirobi[1,2-dihydroindene] is sourced from PubChem (CID 102350291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).