C23H35NO2 — CID 102350514
(3Z,5Z,7S,8S,10Z,13Z,15Z,19S)-8-hydroxy-7,11,13,19-tetramethyl-1-azacycloicosa-3,5,10,13,15-pentaen-2-one (PubChem CID 102350514) has the molecular formula C23H35NO2 and a molecular weight of 357.54 g/mol. Its IUPAC name is (3Z,5Z,7S,8S,10Z,13Z,15Z,19S)-8-hydroxy-7,11,13,19-tetramethyl-1-azacycloicosa-3,5,10,13,15-pentaen-2-one.
| Compound Name | (3Z,5Z,7S,8S,10Z,13Z,15Z,19S)-8-hydroxy-7,11,13,19-tetramethyl-1-azacycloicosa-3,5,10,13,15-pentaen-2-one |
|---|---|
| PubChem CID | 102350514 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | (3Z,5Z,7S,8S,10Z,13Z,15Z,19S)-8-hydroxy-7,11,13,19-tetramethyl-1-azacycloicosa-3,5,10,13,15-pentaen-2-one |
| SMILES | C/C1=C/C=C\CC[C@H](C)CNC(=O)/C=C\C=C/[C@H](C)[C@@H](O)C/C=C(/C)C1 |
| InChI | InChI=1S/C23H35NO2/c1-18-10-6-5-7-11-20(3)17-24-23(26)13-9-8-12-21(4)22(25)15-14-19(2)16-18/h5-6,8-10,12-14,20-22,25H,7,11,15-17H2,1-4H3,(H,24,26)/b6-5-,12-8-,13-9-,18-10-,19-14-/t20-,21-,22-/m0/s1 |
| InChIKey | LHBMGWHGMXXASO-KFKWEDGFSA-N |
| XLogP | 4.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|