About methyl 2-[(3R,6R)-6-methoxy-6-pent-4-ynyldioxan-3-yl]acetate
methyl 2-[(3R,6R)-6-methoxy-6-pent-4-ynyldioxan-3-yl]acetate (PubChem CID 102350590) has the molecular formula C13H20O5
and a molecular weight of 256.30 g/mol. Its IUPAC name is methyl 2-[(3R,6R)-6-methoxy-6-pent-4-ynyldioxan-3-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(3R,6R)-6-methoxy-6-pent-4-ynyldioxan-3-yl]acetate |
| PubChem CID | 102350590 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | methyl 2-[(3R,6R)-6-methoxy-6-pent-4-ynyldioxan-3-yl]acetate |
| SMILES | C#CCCC[C@]1(OC)CC[C@H](CC(=O)OC)OO1 |
| InChI | InChI=1S/C13H20O5/c1-4-5-6-8-13(16-3)9-7-11(17-18-13)10-12(14)15-2/h1,11H,5-10H2,2-3H3/t11-,13-/m1/s1 |
| InChIKey | VSXIUSDEWAKROI-DGCLKSJQSA-N |
| XLogP | 1.81 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(3R,6R)-6-methoxy-6-pent-4-ynyldioxan-3-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(3R,6R)-6-methoxy-6-pent-4-ynyldioxan-3-yl]acetate?
The IUPAC name of methyl 2-[(3R,6R)-6-methoxy-6-pent-4-ynyldioxan-3-yl]acetate (CID 102350590) is methyl 2-[(3R,6R)-6-methoxy-6-pent-4-ynyldioxan-3-yl]acetate.
What is the SMILES notation for methyl 2-[(3R,6R)-6-methoxy-6-pent-4-ynyldioxan-3-yl]acetate?
The canonical SMILES for methyl 2-[(3R,6R)-6-methoxy-6-pent-4-ynyldioxan-3-yl]acetate is C#CCCC[C@]1(OC)CC[C@H](CC(=O)OC)OO1.
What is the InChIKey of methyl 2-[(3R,6R)-6-methoxy-6-pent-4-ynyldioxan-3-yl]acetate?
The InChIKey is VSXIUSDEWAKROI-DGCLKSJQSA-N. The full InChI is InChI=1S/C13H20O5/c1-4-5-6-8-13(16-3)9-7-11(17-18-13)10-12(14)15-2/h1,11H,5-10H2,2-3H3/t11-,13-/m1/s1.
What are the key properties of methyl 2-[(3R,6R)-6-methoxy-6-pent-4-ynyldioxan-3-yl]acetate?
methyl 2-[(3R,6R)-6-methoxy-6-pent-4-ynyldioxan-3-yl]acetate has a molecular weight of 256.30 g/mol, XLogP of 1.81, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3R,6R)-6-methoxy-6-pent-4-ynyldioxan-3-yl]acetate is sourced from PubChem (CID 102350590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).