About quinolin-1-ium-8-ol
quinolin-1-ium-8-ol (PubChem CID 102350623) has the molecular formula C9H6NO+
and a molecular weight of 144.15 g/mol. Its IUPAC name is quinolin-1-ium-8-ol.
Molecular Properties
| Compound Name | quinolin-1-ium-8-ol |
| PubChem CID | 102350623 |
| Molecular Formula | C9H6NO+ |
| Molecular Weight | 144.15 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | quinolin-1-ium-8-ol |
| SMILES | OC1=CC=C=C2C=CC=[N+]=C21 |
| InChI | InChI=1S/C9H5NO/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1-2,4-6H/p+1 |
| InChIKey | WKFKZXVVZIKPJW-UHFFFAOYSA-O |
| XLogP | 0.67 |
| TPSA | 34.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.15 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze quinolin-1-ium-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-1-ium-8-ol?
The IUPAC name of quinolin-1-ium-8-ol (CID 102350623) is quinolin-1-ium-8-ol.
What is the SMILES notation for quinolin-1-ium-8-ol?
The canonical SMILES for quinolin-1-ium-8-ol is OC1=CC=C=C2C=CC=[N+]=C21.
What is the InChIKey of quinolin-1-ium-8-ol?
The InChIKey is WKFKZXVVZIKPJW-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H5NO/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1-2,4-6H/p+1.
What are the key properties of quinolin-1-ium-8-ol?
quinolin-1-ium-8-ol has a molecular weight of 144.15 g/mol, XLogP of 0.67, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-1-ium-8-ol is sourced from PubChem (CID 102350623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).