C13H18F6N6+2 — CID 102350906
4-(4,4,4-trifluorobutyl)-1-[[4-(4,4,4-trifluorobutyl)-1,2,4-triazol-4-ium-1-yl]methyl]-1,2,4-triazol-4-ium (PubChem CID 102350906) has the molecular formula C13H18F6N6+2 and a molecular weight of 372.32 g/mol. Its IUPAC name is 4-(4,4,4-trifluorobutyl)-1-[[4-(4,4,4-trifluorobutyl)-1,2,4-triazol-4-ium-1-yl]methyl]-1,2,4-triazol-4-ium.
| Compound Name | 4-(4,4,4-trifluorobutyl)-1-[[4-(4,4,4-trifluorobutyl)-1,2,4-triazol-4-ium-1-yl]methyl]-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 102350906 |
| Molecular Formula | C13H18F6N6+2 |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 4-(4,4,4-trifluorobutyl)-1-[[4-(4,4,4-trifluorobutyl)-1,2,4-triazol-4-ium-1-yl]methyl]-1,2,4-triazol-4-ium |
| SMILES | FC(F)(F)CCC[n+]1cnn(Cn2c[n+](CCCC(F)(F)F)cn2)c1 |
| InChI | InChI=1S/C13H18F6N6/c14-12(15,16)3-1-5-22-7-20-24(9-22)11-25-10-23(8-21-25)6-2-4-13(17,18)19/h7-10H,1-6,11H2/q+2 |
| InChIKey | QVTWGOCFGUITQP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|