About 2-[(2R,4S)-2-ethoxyoxan-4-yl]-1,1-diphenylhydrazine
2-[(2R,4S)-2-ethoxyoxan-4-yl]-1,1-diphenylhydrazine (PubChem CID 102351117) has the molecular formula C19H24N2O2
and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-[(2R,4S)-2-ethoxyoxan-4-yl]-1,1-diphenylhydrazine.
Molecular Properties
| Compound Name | 2-[(2R,4S)-2-ethoxyoxan-4-yl]-1,1-diphenylhydrazine |
| PubChem CID | 102351117 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 2-[(2R,4S)-2-ethoxyoxan-4-yl]-1,1-diphenylhydrazine |
| SMILES | CCO[C@H]1C[C@@H](NN(c2ccccc2)c2ccccc2)CCO1 |
| InChI | InChI=1S/C19H24N2O2/c1-2-22-19-15-16(13-14-23-19)20-21(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16,19-20H,2,13-15H2,1H3/t16-,19+/m0/s1 |
| InChIKey | UMOZDJIYTNVIJO-QFBILLFUSA-N |
| XLogP | 3.87 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2R,4S)-2-ethoxyoxan-4-yl]-1,1-diphenylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,4S)-2-ethoxyoxan-4-yl]-1,1-diphenylhydrazine?
The IUPAC name of 2-[(2R,4S)-2-ethoxyoxan-4-yl]-1,1-diphenylhydrazine (CID 102351117) is 2-[(2R,4S)-2-ethoxyoxan-4-yl]-1,1-diphenylhydrazine.
What is the SMILES notation for 2-[(2R,4S)-2-ethoxyoxan-4-yl]-1,1-diphenylhydrazine?
The canonical SMILES for 2-[(2R,4S)-2-ethoxyoxan-4-yl]-1,1-diphenylhydrazine is CCO[C@H]1C[C@@H](NN(c2ccccc2)c2ccccc2)CCO1.
What is the InChIKey of 2-[(2R,4S)-2-ethoxyoxan-4-yl]-1,1-diphenylhydrazine?
The InChIKey is UMOZDJIYTNVIJO-QFBILLFUSA-N. The full InChI is InChI=1S/C19H24N2O2/c1-2-22-19-15-16(13-14-23-19)20-21(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16,19-20H,2,13-15H2,1H3/t16-,19+/m0/s1.
What are the key properties of 2-[(2R,4S)-2-ethoxyoxan-4-yl]-1,1-diphenylhydrazine?
2-[(2R,4S)-2-ethoxyoxan-4-yl]-1,1-diphenylhydrazine has a molecular weight of 312.41 g/mol, XLogP of 3.87, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,4S)-2-ethoxyoxan-4-yl]-1,1-diphenylhydrazine is sourced from PubChem (CID 102351117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).