C23H40O2Si — CID 102351337
[(Z,1R)-2-butyl-1-(4-methoxyphenyl)hex-2-enoxy]-triethylsilane (PubChem CID 102351337) has the molecular formula C23H40O2Si and a molecular weight of 376.66 g/mol. Its IUPAC name is [(Z,1R)-2-butyl-1-(4-methoxyphenyl)hex-2-enoxy]-triethylsilane.
| Compound Name | [(Z,1R)-2-butyl-1-(4-methoxyphenyl)hex-2-enoxy]-triethylsilane |
|---|---|
| PubChem CID | 102351337 |
| Molecular Formula | C23H40O2Si |
| Molecular Weight | 376.66 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | [(Z,1R)-2-butyl-1-(4-methoxyphenyl)hex-2-enoxy]-triethylsilane |
| SMILES | CCC/C=C(/CCCC)[C@@H](O[Si](CC)(CC)CC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H40O2Si/c1-7-12-14-20(15-13-8-2)23(25-26(9-3,10-4)11-5)21-16-18-22(24-6)19-17-21/h14,16-19,23H,7-13,15H2,1-6H3/b20-14-/t23-/m1/s1 |
| InChIKey | AIMZLANWHHCECX-QFXXMJIKSA-N |
| XLogP | 7.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.66 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|