About (2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium
(2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium (PubChem CID 102351429) has the molecular formula C15H22NO4P
and a molecular weight of 311.32 g/mol. Its IUPAC name is (2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium.
Molecular Properties
| Compound Name | (2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium |
| PubChem CID | 102351429 |
| Molecular Formula | C15H22NO4P |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium |
| SMILES | CCOP(=O)(OCC)[C@]1(C)C[C@H](c2ccccc2)C=[N+]1[O-] |
| InChI | InChI=1S/C15H22NO4P/c1-4-19-21(18,20-5-2)15(3)11-14(12-16(15)17)13-9-7-6-8-10-13/h6-10,12,14H,4-5,11H2,1-3H3/t14-,15+/m0/s1 |
| InChIKey | FIHMARFQKBBGTA-LSDHHAIUSA-N |
| XLogP | 3.74 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium?
The IUPAC name of (2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium (CID 102351429) is (2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium.
What is the SMILES notation for (2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium?
The canonical SMILES for (2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium is CCOP(=O)(OCC)[C@]1(C)C[C@H](c2ccccc2)C=[N+]1[O-].
What is the InChIKey of (2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium?
The InChIKey is FIHMARFQKBBGTA-LSDHHAIUSA-N. The full InChI is InChI=1S/C15H22NO4P/c1-4-19-21(18,20-5-2)15(3)11-14(12-16(15)17)13-9-7-6-8-10-13/h6-10,12,14H,4-5,11H2,1-3H3/t14-,15+/m0/s1.
What are the key properties of (2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium?
(2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium has a molecular weight of 311.32 g/mol, XLogP of 3.74, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium is sourced from PubChem (CID 102351429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).