C15H22NO4P — CID 102351429
(2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium (PubChem CID 102351429) has the molecular formula C15H22NO4P and a molecular weight of 311.32 g/mol. Its IUPAC name is (2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium.
| Compound Name | (2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium |
|---|---|
| PubChem CID | 102351429 |
| Molecular Formula | C15H22NO4P |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (2R,4R)-2-diethoxyphosphoryl-2-methyl-1-oxido-4-phenyl-3,4-dihydropyrrol-1-ium |
| SMILES | CCOP(=O)(OCC)[C@]1(C)C[C@H](c2ccccc2)C=[N+]1[O-] |
| InChI | InChI=1S/C15H22NO4P/c1-4-19-21(18,20-5-2)15(3)11-14(12-16(15)17)13-9-7-6-8-10-13/h6-10,12,14H,4-5,11H2,1-3H3/t14-,15+/m0/s1 |
| InChIKey | FIHMARFQKBBGTA-LSDHHAIUSA-N |
| XLogP | 3.74 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|