C10H20O2 — CID 102351582
(3R,4R)-2,2-dimethyl-5-methylideneheptane-3,4-diol (PubChem CID 102351582) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is (3R,4R)-2,2-dimethyl-5-methylideneheptane-3,4-diol.
| Compound Name | (3R,4R)-2,2-dimethyl-5-methylideneheptane-3,4-diol |
|---|---|
| PubChem CID | 102351582 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | (3R,4R)-2,2-dimethyl-5-methylideneheptane-3,4-diol |
| SMILES | C=C(CC)[C@@H](O)[C@H](O)C(C)(C)C |
| InChI | InChI=1S/C10H20O2/c1-6-7(2)8(11)9(12)10(3,4)5/h8-9,11-12H,2,6H2,1,3-5H3/t8-,9+/m1/s1 |
| InChIKey | IPPCUAAOZCKCOK-BDAKNGLRSA-N |
| XLogP | 1.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|