C8H15ClO2 — CID 102351638
(4R,6S)-2-(chloromethyl)-2,4,6-trimethyl-1,3-dioxane (PubChem CID 102351638) has the molecular formula C8H15ClO2 and a molecular weight of 178.66 g/mol. Its IUPAC name is (4R,6S)-2-(chloromethyl)-2,4,6-trimethyl-1,3-dioxane.
| Compound Name | (4R,6S)-2-(chloromethyl)-2,4,6-trimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 102351638 |
| Molecular Formula | C8H15ClO2 |
| Molecular Weight | 178.66 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (4R,6S)-2-(chloromethyl)-2,4,6-trimethyl-1,3-dioxane |
| SMILES | C[C@@H]1C[C@H](C)OC(C)(CCl)O1 |
| InChI | InChI=1S/C8H15ClO2/c1-6-4-7(2)11-8(3,5-9)10-6/h6-7H,4-5H2,1-3H3/t6-,7+,8? |
| InChIKey | YYOFADWDVVBZCH-DHBOJHSNSA-N |
| XLogP | 2.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.66 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|