About trimethyl-[1-oxo-2,5,5-tris(trimethylsilyl)silolan-2-yl]silane
trimethyl-[1-oxo-2,5,5-tris(trimethylsilyl)silolan-2-yl]silane (PubChem CID 102352094) has the molecular formula C16H40OSi5
and a molecular weight of 388.93 g/mol. Its IUPAC name is trimethyl-[1-oxo-2,5,5-tris(trimethylsilyl)silolan-2-yl]silane.
Molecular Properties
| Compound Name | trimethyl-[1-oxo-2,5,5-tris(trimethylsilyl)silolan-2-yl]silane |
| PubChem CID | 102352094 |
| Molecular Formula | C16H40OSi5 |
| Molecular Weight | 388.93 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | trimethyl-[1-oxo-2,5,5-tris(trimethylsilyl)silolan-2-yl]silane |
| SMILES | C[Si](C)(C)C1([Si](C)(C)C)CCC([Si](C)(C)C)([Si](C)(C)C)[Si]1=O |
| InChI | InChI=1S/C16H40OSi5/c1-19(2,3)15(20(4,5)6)13-14-16(18(15)17,21(7,8)9)22(10,11)12/h13-14H2,1-12H3 |
| InChIKey | JHKUAQMAUOXMQX-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.93 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[1-oxo-2,5,5-tris(trimethylsilyl)silolan-2-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[1-oxo-2,5,5-tris(trimethylsilyl)silolan-2-yl]silane?
The IUPAC name of trimethyl-[1-oxo-2,5,5-tris(trimethylsilyl)silolan-2-yl]silane (CID 102352094) is trimethyl-[1-oxo-2,5,5-tris(trimethylsilyl)silolan-2-yl]silane.
What is the SMILES notation for trimethyl-[1-oxo-2,5,5-tris(trimethylsilyl)silolan-2-yl]silane?
The canonical SMILES for trimethyl-[1-oxo-2,5,5-tris(trimethylsilyl)silolan-2-yl]silane is C[Si](C)(C)C1([Si](C)(C)C)CCC([Si](C)(C)C)([Si](C)(C)C)[Si]1=O.
What is the InChIKey of trimethyl-[1-oxo-2,5,5-tris(trimethylsilyl)silolan-2-yl]silane?
The InChIKey is JHKUAQMAUOXMQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H40OSi5/c1-19(2,3)15(20(4,5)6)13-14-16(18(15)17,21(7,8)9)22(10,11)12/h13-14H2,1-12H3.
What are the key properties of trimethyl-[1-oxo-2,5,5-tris(trimethylsilyl)silolan-2-yl]silane?
trimethyl-[1-oxo-2,5,5-tris(trimethylsilyl)silolan-2-yl]silane has a molecular weight of 388.93 g/mol, XLogP of 6.19, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[1-oxo-2,5,5-tris(trimethylsilyl)silolan-2-yl]silane is sourced from PubChem (CID 102352094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).