About sodium [(Z)-dec-3-enyl] sulfate
sodium [(Z)-dec-3-enyl] sulfate (PubChem CID 102352098) has the molecular formula C10H19NaO4S
and a molecular weight of 258.31 g/mol. Its IUPAC name is sodium [(Z)-dec-3-enyl] sulfate.
Molecular Properties
| Compound Name | sodium [(Z)-dec-3-enyl] sulfate |
| PubChem CID | 102352098 |
| Molecular Formula | C10H19NaO4S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | sodium [(Z)-dec-3-enyl] sulfate |
| SMILES | CCCCCC/C=C\CCOS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H20O4S.Na/c1-2-3-4-5-6-7-8-9-10-14-15(11,12)13;/h7-8H,2-6,9-10H2,1H3,(H,11,12,13);/q;+1/p-1/b8-7-; |
| InChIKey | XTJZWVCEOFMHJX-CFYXSCKTSA-M |
| XLogP | -0.62 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium [(Z)-dec-3-enyl] sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium [(Z)-dec-3-enyl] sulfate?
The IUPAC name of sodium [(Z)-dec-3-enyl] sulfate (CID 102352098) is sodium [(Z)-dec-3-enyl] sulfate.
What is the SMILES notation for sodium [(Z)-dec-3-enyl] sulfate?
The canonical SMILES for sodium [(Z)-dec-3-enyl] sulfate is CCCCCC/C=C\CCOS(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium [(Z)-dec-3-enyl] sulfate?
The InChIKey is XTJZWVCEOFMHJX-CFYXSCKTSA-M. The full InChI is InChI=1S/C10H20O4S.Na/c1-2-3-4-5-6-7-8-9-10-14-15(11,12)13;/h7-8H,2-6,9-10H2,1H3,(H,11,12,13);/q;+1/p-1/b8-7-;.
What are the key properties of sodium [(Z)-dec-3-enyl] sulfate?
sodium [(Z)-dec-3-enyl] sulfate has a molecular weight of 258.31 g/mol, XLogP of -0.62, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium [(Z)-dec-3-enyl] sulfate is sourced from PubChem (CID 102352098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).