About (4R)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one
(4R)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one (PubChem CID 102352797) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is (4R)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one.
Molecular Properties
| Compound Name | (4R)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one |
| PubChem CID | 102352797 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (4R)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one |
| SMILES | Cc1ccc2c(c1)C(=O)CC[C@@]2(C)O |
| InChI | InChI=1S/C12H14O2/c1-8-3-4-10-9(7-8)11(13)5-6-12(10,2)14/h3-4,7,14H,5-6H2,1-2H3/t12-/m1/s1 |
| InChIKey | UUVVPOMHZJKZSI-GFCCVEGCSA-N |
| XLogP | 2.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one?
The IUPAC name of (4R)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one (CID 102352797) is (4R)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one.
What is the SMILES notation for (4R)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one?
The canonical SMILES for (4R)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one is Cc1ccc2c(c1)C(=O)CC[C@@]2(C)O.
What is the InChIKey of (4R)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one?
The InChIKey is UUVVPOMHZJKZSI-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H14O2/c1-8-3-4-10-9(7-8)11(13)5-6-12(10,2)14/h3-4,7,14H,5-6H2,1-2H3/t12-/m1/s1.
What are the key properties of (4R)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one?
(4R)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one has a molecular weight of 190.24 g/mol, XLogP of 2.18, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-hydroxy-4,7-dimethyl-2,3-dihydronaphthalen-1-one is sourced from PubChem (CID 102352797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).