C14H18O5 — CID 102353107
[(3S,4R,4aS)-6-oxospiro[1,4,4a,5-tetrahydrocyclopenta[c]pyran-3,2'-oxane]-4-yl] acetate (PubChem CID 102353107) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is [(3S,4R,4aS)-6-oxospiro[1,4,4a,5-tetrahydrocyclopenta[c]pyran-3,2'-oxane]-4-yl] acetate.
| Compound Name | [(3S,4R,4aS)-6-oxospiro[1,4,4a,5-tetrahydrocyclopenta[c]pyran-3,2'-oxane]-4-yl] acetate |
|---|---|
| PubChem CID | 102353107 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | [(3S,4R,4aS)-6-oxospiro[1,4,4a,5-tetrahydrocyclopenta[c]pyran-3,2'-oxane]-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2CC(=O)C=C2CO[C@@]12CCCCO2 |
| InChI | InChI=1S/C14H18O5/c1-9(15)19-13-12-7-11(16)6-10(12)8-18-14(13)4-2-3-5-17-14/h6,12-13H,2-5,7-8H2,1H3/t12-,13+,14-/m0/s1 |
| InChIKey | LFAGTCZKOMZPPO-MJBXVCDLSA-N |
| XLogP | 1.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |