About cyclopenta-2,4-dien-1-yl-dimethyl-[2-(4-methylthiophen-3-yl)oxyethyl]azanium
cyclopenta-2,4-dien-1-yl-dimethyl-[2-(4-methylthiophen-3-yl)oxyethyl]azanium (PubChem CID 102353305) has the molecular formula C14H20NOS+
and a molecular weight of 250.39 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-dimethyl-[2-(4-methylthiophen-3-yl)oxyethyl]azanium.
Molecular Properties
| Compound Name | cyclopenta-2,4-dien-1-yl-dimethyl-[2-(4-methylthiophen-3-yl)oxyethyl]azanium |
| PubChem CID | 102353305 |
| Molecular Formula | C14H20NOS+ |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-dimethyl-[2-(4-methylthiophen-3-yl)oxyethyl]azanium |
| SMILES | Cc1cscc1OCC[N+](C)(C)C1C=CC=C1 |
| InChI | InChI=1S/C14H20NOS/c1-12-10-17-11-14(12)16-9-8-15(2,3)13-6-4-5-7-13/h4-7,10-11,13H,8-9H2,1-3H3/q+1 |
| InChIKey | QAVDAENXBNEFKB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-2,4-dien-1-yl-dimethyl-[2-(4-methylthiophen-3-yl)oxyethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-2,4-dien-1-yl-dimethyl-[2-(4-methylthiophen-3-yl)oxyethyl]azanium?
The IUPAC name of cyclopenta-2,4-dien-1-yl-dimethyl-[2-(4-methylthiophen-3-yl)oxyethyl]azanium (CID 102353305) is cyclopenta-2,4-dien-1-yl-dimethyl-[2-(4-methylthiophen-3-yl)oxyethyl]azanium.
What is the SMILES notation for cyclopenta-2,4-dien-1-yl-dimethyl-[2-(4-methylthiophen-3-yl)oxyethyl]azanium?
The canonical SMILES for cyclopenta-2,4-dien-1-yl-dimethyl-[2-(4-methylthiophen-3-yl)oxyethyl]azanium is Cc1cscc1OCC[N+](C)(C)C1C=CC=C1.
What is the InChIKey of cyclopenta-2,4-dien-1-yl-dimethyl-[2-(4-methylthiophen-3-yl)oxyethyl]azanium?
The InChIKey is QAVDAENXBNEFKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20NOS/c1-12-10-17-11-14(12)16-9-8-15(2,3)13-6-4-5-7-13/h4-7,10-11,13H,8-9H2,1-3H3/q+1.
What are the key properties of cyclopenta-2,4-dien-1-yl-dimethyl-[2-(4-methylthiophen-3-yl)oxyethyl]azanium?
cyclopenta-2,4-dien-1-yl-dimethyl-[2-(4-methylthiophen-3-yl)oxyethyl]azanium has a molecular weight of 250.39 g/mol, XLogP of 3.01, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-2,4-dien-1-yl-dimethyl-[2-(4-methylthiophen-3-yl)oxyethyl]azanium is sourced from PubChem (CID 102353305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).