C25H42OSi — CID 102353587
1-(4-tert-butylcyclohexen-1-yl)-7-[tert-butyl(dimethyl)silyl]-5,5-dimethylhepta-1,6-diyn-3-ol (PubChem CID 102353587) has the molecular formula C25H42OSi and a molecular weight of 386.70 g/mol. Its IUPAC name is 1-(4-tert-butylcyclohexen-1-yl)-7-[tert-butyl(dimethyl)silyl]-5,5-dimethylhepta-1,6-diyn-3-ol.
| Compound Name | 1-(4-tert-butylcyclohexen-1-yl)-7-[tert-butyl(dimethyl)silyl]-5,5-dimethylhepta-1,6-diyn-3-ol |
|---|---|
| PubChem CID | 102353587 |
| Molecular Formula | C25H42OSi |
| Molecular Weight | 386.70 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | 1-(4-tert-butylcyclohexen-1-yl)-7-[tert-butyl(dimethyl)silyl]-5,5-dimethylhepta-1,6-diyn-3-ol |
| SMILES | CC(C)(C#C[Si](C)(C)C(C)(C)C)CC(O)C#CC1=CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C25H42OSi/c1-23(2,3)21-14-11-20(12-15-21)13-16-22(26)19-25(7,8)17-18-27(9,10)24(4,5)6/h11,21-22,26H,12,14-15,19H2,1-10H3 |
| InChIKey | VWLUCOVUTBOQOM-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.70 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|