C17H26O8 — CID 102354424
(2R,3R,4S,5S,6R)-2-[(2R)-4-(4-hydroxy-3-methoxyphenyl)butan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 102354424) has the molecular formula C17H26O8 and a molecular weight of 358.39 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(2R)-4-(4-hydroxy-3-methoxyphenyl)butan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[(2R)-4-(4-hydroxy-3-methoxyphenyl)butan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 102354424 |
| Molecular Formula | C17H26O8 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(2R)-4-(4-hydroxy-3-methoxyphenyl)butan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COc1cc(CC[C@@H](C)O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)ccc1O |
| InChI | InChI=1S/C17H26O8/c1-9(3-4-10-5-6-11(19)12(7-10)23-2)24-17-16(22)15(21)14(20)13(8-18)25-17/h5-7,9,13-22H,3-4,8H2,1-2H3/t9-,13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | QRKBNUVFVBRLLQ-HMFLIZJESA-N |
| XLogP | -0.46 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |