C23H42O8Si — CID 102354992
tert-butyl [(3S,5R)-5-[(4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-oxo-1,3-dioxan-4-yl]-5-methoxy-4,4-dimethylpent-1-en-3-yl] carbonate (PubChem CID 102354992) has the molecular formula C23H42O8Si and a molecular weight of 474.67 g/mol. Its IUPAC name is tert-butyl [(3S,5R)-5-[(4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-oxo-1,3-dioxan-4-yl]-5-methoxy-4,4-dimethylpent-1-en-3-yl] carbonate.
| Compound Name | tert-butyl [(3S,5R)-5-[(4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-oxo-1,3-dioxan-4-yl]-5-methoxy-4,4-dimethylpent-1-en-3-yl] carbonate |
|---|---|
| PubChem CID | 102354992 |
| Molecular Formula | C23H42O8Si |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | tert-butyl [(3S,5R)-5-[(4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-oxo-1,3-dioxan-4-yl]-5-methoxy-4,4-dimethylpent-1-en-3-yl] carbonate |
| SMILES | C=C[C@H](OC(=O)OC(C)(C)C)C(C)(C)[C@@H](OC)[C@@H]1OCOC(=O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O8Si/c1-13-15(29-20(25)30-21(2,3)4)23(8,9)18(26-10)16-17(19(24)28-14-27-16)31-32(11,12)22(5,6)7/h13,15-18H,1,14H2,2-12H3/t15-,16+,17-,18-/m0/s1 |
| InChIKey | NZUBPMNUPYOYCZ-MHORFTMASA-N |
| XLogP | 4.82 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|