C13H16O9 — CID 102355125
dimethyl (2S,3S,4S)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2,6-dicarboxylate (PubChem CID 102355125) has the molecular formula C13H16O9 and a molecular weight of 316.26 g/mol. Its IUPAC name is dimethyl (2S,3S,4S)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2,6-dicarboxylate.
| Compound Name | dimethyl (2S,3S,4S)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2,6-dicarboxylate |
|---|---|
| PubChem CID | 102355125 |
| Molecular Formula | C13H16O9 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | dimethyl (2S,3S,4S)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2,6-dicarboxylate |
| SMILES | COC(=O)C1=C[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](C(=O)OC)O1 |
| InChI | InChI=1S/C13H16O9/c1-6(14)20-8-5-9(12(16)18-3)22-11(13(17)19-4)10(8)21-7(2)15/h5,8,10-11H,1-4H3/t8-,10-,11-/m0/s1 |
| InChIKey | GYUUZAPLAZUJDZ-LSJOCFKGSA-N |
| XLogP | -0.52 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|