C13H16O4 — CID 102355312
(1S,4aR,9R,9aR)-1,2,3,4,4a,9-hexahydroxanthene-1,9,9a-triol (PubChem CID 102355312) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (1S,4aR,9R,9aR)-1,2,3,4,4a,9-hexahydroxanthene-1,9,9a-triol.
| Compound Name | (1S,4aR,9R,9aR)-1,2,3,4,4a,9-hexahydroxanthene-1,9,9a-triol |
|---|---|
| PubChem CID | 102355312 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (1S,4aR,9R,9aR)-1,2,3,4,4a,9-hexahydroxanthene-1,9,9a-triol |
| SMILES | O[C@@H]1c2ccccc2O[C@@H]2CCC[C@H](O)[C@@]12O |
| InChI | InChI=1S/C13H16O4/c14-10-6-3-7-11-13(10,16)12(15)8-4-1-2-5-9(8)17-11/h1-2,4-5,10-12,14-16H,3,6-7H2/t10-,11+,12+,13-/m0/s1 |
| InChIKey | PAIJOQLCQSYORH-LOWDOPEQSA-N |
| XLogP | 0.76 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |