C20H25N10O8P — CID 102355348
[(2R,3S,5R)-5-(2-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 102355348) has the molecular formula C20H25N10O8P and a molecular weight of 564.46 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(2-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(2-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 102355348 |
| Molecular Formula | C20H25N10O8P |
| Molecular Weight | 564.46 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | [(2R,3S,5R)-5-(2-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | Nc1ncc2ncn([C@H]3C[C@H](OP(=O)(O)OC[C@H]4O[C@@H](n5cnc6c(N)ncnc65)C[C@@H]4O)[C@@H](CO)O3)c2n1 |
| InChI | InChI=1S/C20H25N10O8P/c21-17-16-19(25-6-24-17)30(8-27-16)14-1-10(32)13(37-14)5-35-39(33,34)38-11-2-15(36-12(11)4-31)29-7-26-9-3-23-20(22)28-18(9)29/h3,6-8,10-15,31-32H,1-2,4-5H2,(H,33,34)(H2,21,24,25)(H2,22,23,28)/t10-,11-,12+,13+,14+,15+/m0/s1 |
| InChIKey | PIPRAYKOVLEEGS-BBZRCZKMSA-N |
| XLogP | -0.74 |
| TPSA | 253.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.46 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|