C17H19NO3 — CID 102356939
methyl (7aS,12aS)-6,8,9,10,11,12a-hexahydrochromeno[3,4-b]indolizine-7a-carboxylate (PubChem CID 102356939) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is methyl (7aS,12aS)-6,8,9,10,11,12a-hexahydrochromeno[3,4-b]indolizine-7a-carboxylate.
| Compound Name | methyl (7aS,12aS)-6,8,9,10,11,12a-hexahydrochromeno[3,4-b]indolizine-7a-carboxylate |
|---|---|
| PubChem CID | 102356939 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | methyl (7aS,12aS)-6,8,9,10,11,12a-hexahydrochromeno[3,4-b]indolizine-7a-carboxylate |
| SMILES | COC(=O)[C@]12C=C3COc4ccccc4[C@H]3N1CCCC2 |
| InChI | InChI=1S/C17H19NO3/c1-20-16(19)17-8-4-5-9-18(17)15-12(10-17)11-21-14-7-3-2-6-13(14)15/h2-3,6-7,10,15H,4-5,8-9,11H2,1H3/t15-,17-/m0/s1 |
| InChIKey | DKVVHEFJBNMGMI-RDJZCZTQSA-N |
| XLogP | 2.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|