C24H29NO4 — CID 102357282
methyl (1S,5S)-5-[bis[(4-methoxyphenyl)methyl]amino]cyclohex-3-ene-1-carboxylate (PubChem CID 102357282) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is methyl (1S,5S)-5-[bis[(4-methoxyphenyl)methyl]amino]cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S,5S)-5-[bis[(4-methoxyphenyl)methyl]amino]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 102357282 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | methyl (1S,5S)-5-[bis[(4-methoxyphenyl)methyl]amino]cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC=C[C@@H](N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C24H29NO4/c1-27-22-11-7-18(8-12-22)16-25(17-19-9-13-23(28-2)14-10-19)21-6-4-5-20(15-21)24(26)29-3/h4,6-14,20-21H,5,15-17H2,1-3H3/t20-,21+/m0/s1 |
| InChIKey | RFHTUVZWPLIEDS-LEWJYISDSA-N |
| XLogP | 4.21 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|