C21H23PS — CID 102357317
(5-tert-butylsulfanylcyclopenta-1,3-dien-1-yl)-diphenylphosphane (PubChem CID 102357317) has the molecular formula C21H23PS and a molecular weight of 338.46 g/mol. Its IUPAC name is (5-tert-butylsulfanylcyclopenta-1,3-dien-1-yl)-diphenylphosphane.
| Compound Name | (5-tert-butylsulfanylcyclopenta-1,3-dien-1-yl)-diphenylphosphane |
|---|---|
| PubChem CID | 102357317 |
| Molecular Formula | C21H23PS |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (5-tert-butylsulfanylcyclopenta-1,3-dien-1-yl)-diphenylphosphane |
| SMILES | CC(C)(C)SC1C=CC=C1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23PS/c1-21(2,3)23-20-16-10-15-19(20)22(17-11-6-4-7-12-17)18-13-8-5-9-14-18/h4-16,20H,1-3H3 |
| InChIKey | KDWPSZNMLUWZCV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|