About (4S,5S)-5-[(Z)-but-2-enyl]-3-butyl-4-(2-oxodecyl)-1,3-oxazolidin-2-one
(4S,5S)-5-[(Z)-but-2-enyl]-3-butyl-4-(2-oxodecyl)-1,3-oxazolidin-2-one (PubChem CID 102357430) has the molecular formula C21H37NO3
and a molecular weight of 351.53 g/mol. Its IUPAC name is (4S,5S)-5-[(Z)-but-2-enyl]-3-butyl-4-(2-oxodecyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4S,5S)-5-[(Z)-but-2-enyl]-3-butyl-4-(2-oxodecyl)-1,3-oxazolidin-2-one |
| PubChem CID | 102357430 |
| Molecular Formula | C21H37NO3 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.28 |
| IUPAC Name | (4S,5S)-5-[(Z)-but-2-enyl]-3-butyl-4-(2-oxodecyl)-1,3-oxazolidin-2-one |
| SMILES | C/C=C\C[C@@H]1OC(=O)N(CCCC)[C@H]1CC(=O)CCCCCCCC |
| InChI | InChI=1S/C21H37NO3/c1-4-7-10-11-12-13-14-18(23)17-19-20(15-8-5-2)25-21(24)22(19)16-9-6-3/h5,8,19-20H,4,6-7,9-17H2,1-3H3/b8-5-/t19-,20-/m0/s1 |
| InChIKey | FSGVLJOLURMTCI-GBPPQEEDSA-N |
| XLogP | 5.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S,5S)-5-[(Z)-but-2-enyl]-3-butyl-4-(2-oxodecyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-5-[(Z)-but-2-enyl]-3-butyl-4-(2-oxodecyl)-1,3-oxazolidin-2-one?
The IUPAC name of (4S,5S)-5-[(Z)-but-2-enyl]-3-butyl-4-(2-oxodecyl)-1,3-oxazolidin-2-one (CID 102357430) is (4S,5S)-5-[(Z)-but-2-enyl]-3-butyl-4-(2-oxodecyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for (4S,5S)-5-[(Z)-but-2-enyl]-3-butyl-4-(2-oxodecyl)-1,3-oxazolidin-2-one?
The canonical SMILES for (4S,5S)-5-[(Z)-but-2-enyl]-3-butyl-4-(2-oxodecyl)-1,3-oxazolidin-2-one is C/C=C\C[C@@H]1OC(=O)N(CCCC)[C@H]1CC(=O)CCCCCCCC.
What is the InChIKey of (4S,5S)-5-[(Z)-but-2-enyl]-3-butyl-4-(2-oxodecyl)-1,3-oxazolidin-2-one?
The InChIKey is FSGVLJOLURMTCI-GBPPQEEDSA-N. The full InChI is InChI=1S/C21H37NO3/c1-4-7-10-11-12-13-14-18(23)17-19-20(15-8-5-2)25-21(24)22(19)16-9-6-3/h5,8,19-20H,4,6-7,9-17H2,1-3H3/b8-5-/t19-,20-/m0/s1.
What are the key properties of (4S,5S)-5-[(Z)-but-2-enyl]-3-butyl-4-(2-oxodecyl)-1,3-oxazolidin-2-one?
(4S,5S)-5-[(Z)-but-2-enyl]-3-butyl-4-(2-oxodecyl)-1,3-oxazolidin-2-one has a molecular weight of 351.53 g/mol, XLogP of 5.65, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-5-[(Z)-but-2-enyl]-3-butyl-4-(2-oxodecyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 102357430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).