C20H13F13N2O2 — CID 102357874
ethyl 2-cyano-2-[1-methyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)indol-3-yl]acetate (PubChem CID 102357874) has the molecular formula C20H13F13N2O2 and a molecular weight of 560.31 g/mol. Its IUPAC name is ethyl 2-cyano-2-[1-methyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)indol-3-yl]acetate.
| Compound Name | ethyl 2-cyano-2-[1-methyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)indol-3-yl]acetate |
|---|---|
| PubChem CID | 102357874 |
| Molecular Formula | C20H13F13N2O2 |
| Molecular Weight | 560.31 g/mol |
| Exact Mass | 560.08 |
| IUPAC Name | ethyl 2-cyano-2-[1-methyl-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)indol-3-yl]acetate |
| SMILES | CCOC(=O)C(C#N)c1c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n(C)c2ccccc12 |
| InChI | InChI=1S/C20H13F13N2O2/c1-3-37-14(36)10(8-34)12-9-6-4-5-7-11(9)35(2)13(12)15(21,22)16(23,24)17(25,26)18(27,28)19(29,30)20(31,32)33/h4-7,10H,3H2,1-2H3 |
| InChIKey | XVCLCGXXMGTBOC-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.31 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|