C11H12FNO — CID 102357907
8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one (PubChem CID 102357907) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is 8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one.
| Compound Name | 8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 102357907 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one |
| SMILES | CC1(C)Cc2cccc(F)c2NC1=O |
| InChI | InChI=1S/C11H12FNO/c1-11(2)6-7-4-3-5-8(12)9(7)13-10(11)14/h3-5H,6H2,1-2H3,(H,13,14) |
| InChIKey | XKDLMTRQLBIBNE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |