About 8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one
8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one (PubChem CID 102357907) has the molecular formula C11H12FNO
and a molecular weight of 193.22 g/mol. Its IUPAC name is 8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one |
| PubChem CID | 102357907 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one |
| SMILES | CC1(C)Cc2cccc(F)c2NC1=O |
| InChI | InChI=1S/C11H12FNO/c1-11(2)6-7-4-3-5-8(12)9(7)13-10(11)14/h3-5H,6H2,1-2H3,(H,13,14) |
| InChIKey | XKDLMTRQLBIBNE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one?
The IUPAC name of 8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one (CID 102357907) is 8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one.
What is the SMILES notation for 8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one?
The canonical SMILES for 8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one is CC1(C)Cc2cccc(F)c2NC1=O.
What is the InChIKey of 8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one?
The InChIKey is XKDLMTRQLBIBNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNO/c1-11(2)6-7-4-3-5-8(12)9(7)13-10(11)14/h3-5H,6H2,1-2H3,(H,13,14).
What are the key properties of 8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one?
8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one has a molecular weight of 193.22 g/mol, XLogP of 2.35, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-3,3-dimethyl-1,4-dihydroquinolin-2-one is sourced from PubChem (CID 102357907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).