C22H39NO — CID 102358162
(2E)-3,7-dimethyl-N-[2-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]octa-2,6-dien-1-amine (PubChem CID 102358162) has the molecular formula C22H39NO and a molecular weight of 333.56 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-N-[2-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]octa-2,6-dien-1-amine.
| Compound Name | (2E)-3,7-dimethyl-N-[2-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]octa-2,6-dien-1-amine |
|---|---|
| PubChem CID | 102358162 |
| Molecular Formula | C22H39NO |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.30 |
| IUPAC Name | (2E)-3,7-dimethyl-N-[2-[[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl]octa-2,6-dien-1-amine |
| SMILES | CC(C)=CCC/C(C)=C/CNCCO[C@@H]1C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C22H39NO/c1-17(2)8-7-9-18(3)11-13-23-14-15-24-20-16-19-10-12-22(20,6)21(19,4)5/h8,11,19-20,23H,7,9-10,12-16H2,1-6H3/b18-11+/t19-,20-,22-/m1/s1 |
| InChIKey | XJZQWBNCSAHKPP-IGMSSFCZSA-N |
| XLogP | 5.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|