C54H36O8 — CID 102359058
4-[4-[1,2,2-tris[4-(4-carboxyphenyl)phenyl]ethenyl]phenyl]benzoic acid (PubChem CID 102359058) has the molecular formula C54H36O8 and a molecular weight of 812.87 g/mol. Its IUPAC name is 4-[4-[1,2,2-tris[4-(4-carboxyphenyl)phenyl]ethenyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[1,2,2-tris[4-(4-carboxyphenyl)phenyl]ethenyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 102359058 |
| Molecular Formula | C54H36O8 |
| Molecular Weight | 812.87 g/mol |
| Exact Mass | 812.24 |
| IUPAC Name | 4-[4-[1,2,2-tris[4-(4-carboxyphenyl)phenyl]ethenyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(C(=C(c3ccc(-c4ccc(C(=O)O)cc4)cc3)c3ccc(-c4ccc(C(=O)O)cc4)cc3)c3ccc(-c4ccc(C(=O)O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C54H36O8/c55-51(56)45-25-9-37(10-26-45)33-1-17-41(18-2-33)49(42-19-3-34(4-20-42)38-11-27-46(28-12-38)52(57)58)50(43-21-5-35(6-22-43)39-13-29-47(30-14-39)53(59)60)44-23-7-36(8-24-44)40-15-31-48(32-16-40)54(61)62/h1-32H,(H,55,56)(H,57,58)(H,59,60)(H,61,62) |
| InChIKey | IIIWRSPHUBZZOB-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.87 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|