About 2,3,6-trimethylbenzaldehyde
2,3,6-trimethylbenzaldehyde (PubChem CID 10236014) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is 2,3,6-trimethylbenzaldehyde.
Molecular Properties
| Compound Name | 2,3,6-trimethylbenzaldehyde |
| PubChem CID | 10236014 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 2,3,6-trimethylbenzaldehyde |
| SMILES | Cc1ccc(C)c(C=O)c1C |
| InChI | InChI=1S/C10H12O/c1-7-4-5-8(2)10(6-11)9(7)3/h4-6H,1-3H3 |
| InChIKey | NHMDCMLCZRILTI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,3,6-trimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,6-trimethylbenzaldehyde?
The IUPAC name of 2,3,6-trimethylbenzaldehyde (CID 10236014) is 2,3,6-trimethylbenzaldehyde.
What is the SMILES notation for 2,3,6-trimethylbenzaldehyde?
The canonical SMILES for 2,3,6-trimethylbenzaldehyde is Cc1ccc(C)c(C=O)c1C.
What is the InChIKey of 2,3,6-trimethylbenzaldehyde?
The InChIKey is NHMDCMLCZRILTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O/c1-7-4-5-8(2)10(6-11)9(7)3/h4-6H,1-3H3.
What are the key properties of 2,3,6-trimethylbenzaldehyde?
2,3,6-trimethylbenzaldehyde has a molecular weight of 148.20 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,6-trimethylbenzaldehyde is sourced from PubChem (CID 10236014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).