About 2,5-bis[fluoro(dinitro)methyl]-1,3,4-oxadiazole
2,5-bis[fluoro(dinitro)methyl]-1,3,4-oxadiazole (PubChem CID 102360188) has the molecular formula C4F2N6O9
and a molecular weight of 314.07 g/mol. Its IUPAC name is 2,5-bis[fluoro(dinitro)methyl]-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2,5-bis[fluoro(dinitro)methyl]-1,3,4-oxadiazole |
| PubChem CID | 102360188 |
| Molecular Formula | C4F2N6O9 |
| Molecular Weight | 314.07 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | 2,5-bis[fluoro(dinitro)methyl]-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])C(F)(c1nnc(C(F)([N+](=O)[O-])[N+](=O)[O-])o1)[N+](=O)[O-] |
| InChI | InChI=1S/C4F2N6O9/c5-3(9(13)14,10(15)16)1-7-8-2(21-1)4(6,11(17)18)12(19)20 |
| InChIKey | RFOYLDCSOGJHQW-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 211.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.07 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis[fluoro(dinitro)methyl]-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis[fluoro(dinitro)methyl]-1,3,4-oxadiazole?
The IUPAC name of 2,5-bis[fluoro(dinitro)methyl]-1,3,4-oxadiazole (CID 102360188) is 2,5-bis[fluoro(dinitro)methyl]-1,3,4-oxadiazole.
What is the SMILES notation for 2,5-bis[fluoro(dinitro)methyl]-1,3,4-oxadiazole?
The canonical SMILES for 2,5-bis[fluoro(dinitro)methyl]-1,3,4-oxadiazole is O=[N+]([O-])C(F)(c1nnc(C(F)([N+](=O)[O-])[N+](=O)[O-])o1)[N+](=O)[O-].
What is the InChIKey of 2,5-bis[fluoro(dinitro)methyl]-1,3,4-oxadiazole?
The InChIKey is RFOYLDCSOGJHQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4F2N6O9/c5-3(9(13)14,10(15)16)1-7-8-2(21-1)4(6,11(17)18)12(19)20.
What are the key properties of 2,5-bis[fluoro(dinitro)methyl]-1,3,4-oxadiazole?
2,5-bis[fluoro(dinitro)methyl]-1,3,4-oxadiazole has a molecular weight of 314.07 g/mol, XLogP of -0.66, 6 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis[fluoro(dinitro)methyl]-1,3,4-oxadiazole is sourced from PubChem (CID 102360188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).