C21H15F6NOS — CID 102360307
4-[2-(1,2-dimethylindol-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophene-2-carbaldehyde (PubChem CID 102360307) has the molecular formula C21H15F6NOS and a molecular weight of 443.41 g/mol. Its IUPAC name is 4-[2-(1,2-dimethylindol-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophene-2-carbaldehyde.
| Compound Name | 4-[2-(1,2-dimethylindol-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 102360307 |
| Molecular Formula | C21H15F6NOS |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 4-[2-(1,2-dimethylindol-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophene-2-carbaldehyde |
| SMILES | Cc1sc(C=O)cc1C1=C(c2c(C)n(C)c3ccccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C21H15F6NOS/c1-10-16(13-6-4-5-7-15(13)28(10)3)18-17(14-8-12(9-29)30-11(14)2)19(22,23)21(26,27)20(18,24)25/h4-9H,1-3H3 |
| InChIKey | QEYVNJPTHKUEAG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|