C16H12F7NO — CID 102360310
3-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-5-methoxy-1,2-dimethylindole (PubChem CID 102360310) has the molecular formula C16H12F7NO and a molecular weight of 367.26 g/mol. Its IUPAC name is 3-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-5-methoxy-1,2-dimethylindole.
| Compound Name | 3-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-5-methoxy-1,2-dimethylindole |
|---|---|
| PubChem CID | 102360310 |
| Molecular Formula | C16H12F7NO |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 3-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-5-methoxy-1,2-dimethylindole |
| SMILES | COc1ccc2c(c1)c(C1=C(F)C(F)(F)C(F)(F)C1(F)F)c(C)n2C |
| InChI | InChI=1S/C16H12F7NO/c1-7-11(9-6-8(25-3)4-5-10(9)24(7)2)12-13(17)15(20,21)16(22,23)14(12,18)19/h4-6H,1-3H3 |
| InChIKey | RGTRVMXTVWRZNC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|