C8H12N4O+2 — CID 10236045
2,5,7-trimethyl-1H-pyrazolo[5,4-d]pyrimidine-2,7-diium-4-one (PubChem CID 10236045) has the molecular formula C8H12N4O+2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2,5,7-trimethyl-1H-pyrazolo[5,4-d]pyrimidine-2,7-diium-4-one.
| Compound Name | 2,5,7-trimethyl-1H-pyrazolo[5,4-d]pyrimidine-2,7-diium-4-one |
|---|---|
| PubChem CID | 10236045 |
| Molecular Formula | C8H12N4O+2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 2,5,7-trimethyl-1H-pyrazolo[5,4-d]pyrimidine-2,7-diium-4-one |
| SMILES | Cn1c[n+](C)c2[nH][n+](C)cc2c1=O |
| InChI | InChI=1S/C8H11N4O/c1-10-5-11(2)8(13)6-4-12(3)9-7(6)10/h4-5H,1-3H3/q+1/p+1 |
| InChIKey | ZYVXBRRASDLZJD-UHFFFAOYSA-O |
| XLogP | -1.48 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|