C40H20S10+4 — CID 102360532
2-[2,3,4,5-tetrakis(1,3-benzodithiol-3-ium-2-yl)cyclopenta-2,4-dien-1-ylidene]-1,3-benzodithiole (PubChem CID 102360532) has the molecular formula C40H20S10+4 and a molecular weight of 821.27 g/mol. Its IUPAC name is 2-[2,3,4,5-tetrakis(1,3-benzodithiol-3-ium-2-yl)cyclopenta-2,4-dien-1-ylidene]-1,3-benzodithiole.
| Compound Name | 2-[2,3,4,5-tetrakis(1,3-benzodithiol-3-ium-2-yl)cyclopenta-2,4-dien-1-ylidene]-1,3-benzodithiole |
|---|---|
| PubChem CID | 102360532 |
| Molecular Formula | C40H20S10+4 |
| Molecular Weight | 821.27 g/mol |
| Exact Mass | 819.88 |
| IUPAC Name | 2-[2,3,4,5-tetrakis(1,3-benzodithiol-3-ium-2-yl)cyclopenta-2,4-dien-1-ylidene]-1,3-benzodithiole |
| SMILES | c1ccc2c(c1)SC(=C1C(c3sc4ccccc4[s+]3)=C(c3sc4ccccc4[s+]3)C(c3sc4ccccc4[s+]3)=C1c1sc3ccccc3[s+]1)S2 |
| InChI | InChI=1S/C40H20S10/c1-2-12-22-21(11-1)41-36(42-22)31-32(37-43-23-13-3-4-14-24(23)44-37)34(39-47-27-17-7-8-18-28(27)48-39)35(40-49-29-19-9-10-20-30(29)50-40)33(31)38-45-25-15-5-6-16-26(25)46-38/h1-20H/q+4 |
| InChIKey | OONOSWAISVLKKC-UHFFFAOYSA-N |
| XLogP | 16.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.27 |
| LogP ≤ 5 | 16.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|