C12H13NO — CID 10236056
1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-4-ol (PubChem CID 10236056) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 10236056 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1-(prop-2-ynylamino)-2,3-dihydro-1H-inden-4-ol |
| SMILES | C#CCNC1CCc2c(O)cccc21 |
| InChI | InChI=1S/C12H13NO/c1-2-8-13-11-7-6-10-9(11)4-3-5-12(10)14/h1,3-5,11,13-14H,6-8H2 |
| InChIKey | MQJZMFWAGYASSM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|