About 2-propyl-1H-imidazole-4,5-dicarboxylic acid
2-propyl-1H-imidazole-4,5-dicarboxylic acid (PubChem CID 10236071) has the molecular formula C8H10N2O4
and a molecular weight of 198.18 g/mol. Its IUPAC name is 2-propyl-1H-imidazole-4,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-propyl-1H-imidazole-4,5-dicarboxylic acid |
| PubChem CID | 10236071 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 2-propyl-1H-imidazole-4,5-dicarboxylic acid |
| SMILES | CCCc1nc(C(=O)O)c(C(=O)O)[nH]1 |
| InChI | InChI=1S/C8H10N2O4/c1-2-3-4-9-5(7(11)12)6(10-4)8(13)14/h2-3H2,1H3,(H,9,10)(H,11,12)(H,13,14) |
| InChIKey | BGPZYJSOTDBJMV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propyl-1H-imidazole-4,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-1H-imidazole-4,5-dicarboxylic acid?
The IUPAC name of 2-propyl-1H-imidazole-4,5-dicarboxylic acid (CID 10236071) is 2-propyl-1H-imidazole-4,5-dicarboxylic acid.
What is the SMILES notation for 2-propyl-1H-imidazole-4,5-dicarboxylic acid?
The canonical SMILES for 2-propyl-1H-imidazole-4,5-dicarboxylic acid is CCCc1nc(C(=O)O)c(C(=O)O)[nH]1.
What is the InChIKey of 2-propyl-1H-imidazole-4,5-dicarboxylic acid?
The InChIKey is BGPZYJSOTDBJMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4/c1-2-3-4-9-5(7(11)12)6(10-4)8(13)14/h2-3H2,1H3,(H,9,10)(H,11,12)(H,13,14).
What are the key properties of 2-propyl-1H-imidazole-4,5-dicarboxylic acid?
2-propyl-1H-imidazole-4,5-dicarboxylic acid has a molecular weight of 198.18 g/mol, XLogP of 0.76, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-1H-imidazole-4,5-dicarboxylic acid is sourced from PubChem (CID 10236071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).