C20H22O10 — CID 102360730
(2R,3S)-2-(3,4-dihydroxyphenyl)-8-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]-3,4-dihydro-2H-chromene-3,5,7-triol (PubChem CID 102360730) has the molecular formula C20H22O10 and a molecular weight of 422.39 g/mol. Its IUPAC name is (2R,3S)-2-(3,4-dihydroxyphenyl)-8-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]-3,4-dihydro-2H-chromene-3,5,7-triol.
| Compound Name | (2R,3S)-2-(3,4-dihydroxyphenyl)-8-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 102360730 |
| Molecular Formula | C20H22O10 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | (2R,3S)-2-(3,4-dihydroxyphenyl)-8-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES | Oc1ccc([C@H]2Oc3c(c(O)cc(O)c3[C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)C[C@@H]2O)cc1O |
| InChI | InChI=1S/C20H22O10/c21-9-2-1-7(3-11(9)23)18-13(25)4-8-10(22)5-12(24)15(19(8)30-18)20-17(28)16(27)14(26)6-29-20/h1-3,5,13-14,16-18,20-28H,4,6H2/t13-,14+,16-,17+,18+,20-/m0/s1 |
| InChIKey | KSXMZJPPJSRTDJ-KCKUPIAKSA-N |
| XLogP | -0.30 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|