C26H15N5O7S — CID 102360948
N-[4-[(E)-2-[4-(dicyanomethylidene)chromen-2-yl]ethenyl]phenyl]-2,4-dinitrobenzenesulfonamide (PubChem CID 102360948) has the molecular formula C26H15N5O7S and a molecular weight of 541.50 g/mol. Its IUPAC name is N-[4-[(E)-2-[4-(dicyanomethylidene)chromen-2-yl]ethenyl]phenyl]-2,4-dinitrobenzenesulfonamide.
| Compound Name | N-[4-[(E)-2-[4-(dicyanomethylidene)chromen-2-yl]ethenyl]phenyl]-2,4-dinitrobenzenesulfonamide |
|---|---|
| PubChem CID | 102360948 |
| Molecular Formula | C26H15N5O7S |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 541.07 |
| IUPAC Name | N-[4-[(E)-2-[4-(dicyanomethylidene)chromen-2-yl]ethenyl]phenyl]-2,4-dinitrobenzenesulfonamide |
| SMILES | N#CC(C#N)=C1C=C(/C=C/c2ccc(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)Oc2ccccc21 |
| InChI | InChI=1S/C26H15N5O7S/c27-15-18(16-28)23-14-21(38-25-4-2-1-3-22(23)25)11-7-17-5-8-19(9-6-17)29-39(36,37)26-12-10-20(30(32)33)13-24(26)31(34)35/h1-14,29H/b11-7+ |
| InChIKey | BRWNYSUMTMEZEY-YRNVUSSQSA-N |
| XLogP | 5.09 |
| TPSA | 189.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|