About spiro[9H-anthracene-10,3'-pyrrolidine]
spiro[9H-anthracene-10,3'-pyrrolidine] (PubChem CID 10236153) has the molecular formula C17H17N
and a molecular weight of 235.33 g/mol. Its IUPAC name is spiro[9H-anthracene-10,3'-pyrrolidine].
Molecular Properties
| Compound Name | spiro[9H-anthracene-10,3'-pyrrolidine] |
| PubChem CID | 10236153 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | spiro[9H-anthracene-10,3'-pyrrolidine] |
| SMILES | c1ccc2c(c1)Cc1ccccc1C21CCNC1 |
| InChI | InChI=1S/C17H17N/c1-3-7-15-13(5-1)11-14-6-2-4-8-16(14)17(15)9-10-18-12-17/h1-8,18H,9-12H2 |
| InChIKey | LKSUTFUZSGZMOS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[9H-anthracene-10,3'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[9H-anthracene-10,3'-pyrrolidine]?
The IUPAC name of spiro[9H-anthracene-10,3'-pyrrolidine] (CID 10236153) is spiro[9H-anthracene-10,3'-pyrrolidine].
What is the SMILES notation for spiro[9H-anthracene-10,3'-pyrrolidine]?
The canonical SMILES for spiro[9H-anthracene-10,3'-pyrrolidine] is c1ccc2c(c1)Cc1ccccc1C21CCNC1.
What is the InChIKey of spiro[9H-anthracene-10,3'-pyrrolidine]?
The InChIKey is LKSUTFUZSGZMOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N/c1-3-7-15-13(5-1)11-14-6-2-4-8-16(14)17(15)9-10-18-12-17/h1-8,18H,9-12H2.
What are the key properties of spiro[9H-anthracene-10,3'-pyrrolidine]?
spiro[9H-anthracene-10,3'-pyrrolidine] has a molecular weight of 235.33 g/mol, XLogP of 2.87, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[9H-anthracene-10,3'-pyrrolidine] is sourced from PubChem (CID 10236153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).