C22H34O8Si — CID 102361628
[(2R,3R,4S,5R,6S)-4-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] benzoate (PubChem CID 102361628) has the molecular formula C22H34O8Si and a molecular weight of 454.59 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-4-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 102361628 |
| Molecular Formula | C22H34O8Si |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4-acetyloxy-5-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] benzoate |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](OC(=O)c2ccccc2)[C@H](OC(C)=O)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H34O8Si/c1-14(24)27-18-17(29-20(25)15-11-9-8-10-12-15)16(13-23)28-21(26-5)19(18)30-31(6,7)22(2,3)4/h8-12,16-19,21,23H,13H2,1-7H3/t16-,17-,18+,19-,21+/m1/s1 |
| InChIKey | SSULKUPRXCQIED-YRIDSSQKSA-N |
| XLogP | 2.90 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|