C15H22O2 — CID 102361907
(4R,4aS,6R)-3',3',4,4a-tetramethylspiro[4,5,7,8-tetrahydro-3H-naphthalene-6,2'-oxirane]-2-one (PubChem CID 102361907) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (4R,4aS,6R)-3',3',4,4a-tetramethylspiro[4,5,7,8-tetrahydro-3H-naphthalene-6,2'-oxirane]-2-one.
| Compound Name | (4R,4aS,6R)-3',3',4,4a-tetramethylspiro[4,5,7,8-tetrahydro-3H-naphthalene-6,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 102361907 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (4R,4aS,6R)-3',3',4,4a-tetramethylspiro[4,5,7,8-tetrahydro-3H-naphthalene-6,2'-oxirane]-2-one |
| SMILES | C[C@@H]1CC(=O)C=C2CC[C@]3(C[C@]21C)OC3(C)C |
| InChI | InChI=1S/C15H22O2/c1-10-7-12(16)8-11-5-6-15(9-14(10,11)4)13(2,3)17-15/h8,10H,5-7,9H2,1-4H3/t10-,14+,15-/m1/s1 |
| InChIKey | NBJSLZLLGUKEDK-WKPIXPDZSA-N |
| XLogP | 3.26 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|