C18H19NO5 — CID 102362141
ethyl 2-(benzylamino)-2-(6-hydroxy-1,3-benzodioxol-5-yl)acetate (PubChem CID 102362141) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is ethyl 2-(benzylamino)-2-(6-hydroxy-1,3-benzodioxol-5-yl)acetate.
| Compound Name | ethyl 2-(benzylamino)-2-(6-hydroxy-1,3-benzodioxol-5-yl)acetate |
|---|---|
| PubChem CID | 102362141 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | ethyl 2-(benzylamino)-2-(6-hydroxy-1,3-benzodioxol-5-yl)acetate |
| SMILES | CCOC(=O)C(NCc1ccccc1)c1cc2c(cc1O)OCO2 |
| InChI | InChI=1S/C18H19NO5/c1-2-22-18(21)17(19-10-12-6-4-3-5-7-12)13-8-15-16(9-14(13)20)24-11-23-15/h3-9,17,19-20H,2,10-11H2,1H3 |
| InChIKey | RYFCPEFNWCQWPB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|