C39H43FN4O — CID 102362184
[(3aR,8bS)-4-benzyl-8b-[(4-fluorophenyl)diazenyl]-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-3-yl]-[2,4,6-tri(propan-2-yl)phenyl]methanone (PubChem CID 102362184) has the molecular formula C39H43FN4O and a molecular weight of 602.80 g/mol. Its IUPAC name is [(3aR,8bS)-4-benzyl-8b-[(4-fluorophenyl)diazenyl]-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-3-yl]-[2,4,6-tri(propan-2-yl)phenyl]methanone.
| Compound Name | [(3aR,8bS)-4-benzyl-8b-[(4-fluorophenyl)diazenyl]-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-3-yl]-[2,4,6-tri(propan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 102362184 |
| Molecular Formula | C39H43FN4O |
| Molecular Weight | 602.80 g/mol |
| Exact Mass | 602.34 |
| IUPAC Name | [(3aR,8bS)-4-benzyl-8b-[(4-fluorophenyl)diazenyl]-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-3-yl]-[2,4,6-tri(propan-2-yl)phenyl]methanone |
| SMILES | CC(C)c1cc(C(C)C)c(C(=O)N2CC[C@]3(/N=N/c4ccc(F)cc4)c4ccccc4N(Cc4ccccc4)[C@H]23)c(C(C)C)c1 |
| InChI | InChI=1S/C39H43FN4O/c1-25(2)29-22-32(26(3)4)36(33(23-29)27(5)6)37(45)43-21-20-39(42-41-31-18-16-30(40)17-19-31)34-14-10-11-15-35(34)44(38(39)43)24-28-12-8-7-9-13-28/h7-19,22-23,25-27,38H,20-21,24H2,1-6H3/b42-41+/t38-,39-/m0/s1 |
| InChIKey | DDWAFNQRWNKTIU-BJDZJSLRSA-N |
| XLogP | 10.07 |
| TPSA | 48.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.80 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|